945633-30-7
Chemical Structure
Biotin-PEG2-CH2CH2N3
- CAS No.: 945633-30-7
- Formula:C16H28N6O4S
- Molecular Weight:400.50
IUPAC Name: N-(2-(2-(2-azidoethoxy)ethoxy)ethyl)-5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamide
InChIKey: OVEZMVONEJMGLZ-YDHLFZDLSA-N
SMILES: O=C(NCCOCCOCCN=[N+]=[N-])CCCC[C@@H]1SC[C@]([C@]1([H])N2)([H])NC2=O
Biological Activity: Biotin-PEG2-CH2CH2N3 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Biotin-PEG2-CH2CH2N3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Biotin-PEG2-CH2CH2N3 | 99.07% | Biotin-PEG2-CH2CH2N3 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Biotin-PEG2-CH2CH2N3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||