611-91-6
Chemical Structure
Chalcone dibromide
- CAS No.: 611-91-6
- Formula:C15H12Br2O
- Molecular Weight:368.06
IUPAC Name: 2,3-dibromo-1,3-diphenylpropan-1-one
InChIKey: LYAGBKGGYRLVTR-UHFFFAOYSA-N
SMILES: O=C(C1=CC=CC=C1)C(Br)C(Br)C2=CC=CC=C2
Biological Activity: Chalcone dibromide is a useful synthon in the synthesis of a large number of bioactive molecules such as pyrazolines, hydroxy pyrazolines, isoxazoles etc. Chalcone dibromide possesses antioxidant effects against tumor cells by inhibiting superoxide production and lipid peroxidation. Chalcone dibromide can be used for cancer disease research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Chalcone dibromide | 95.0% | Chalcone dibromide is a useful synthon in the synthesis of a large number of bioactive molecules such as pyrazolines, hydroxy pyrazolines, isoxazoles etc. Chalcone dibromide possesses antioxidant effects against tumor cells by inhibiting superoxide production and lipid peroxidation. Chalcone dibromide can be used for cancer disease research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||