113457-06-0
Chemical Structure
PD 121373
- CAS No.: 113457-06-0
- Formula:C21H27N5OS
- Molecular Weight:397.54
IUPAC Name: 5-((2-aminoethyl)amino)-2-(2-(diethylamino)ethyl)-2H-thiochromeno[4,3,2-cd]indazol-9-ol
InChIKey: UXIMOIBPXBNYNC-UHFFFAOYSA-N
SMILES: OC1=CC2=C(SC3=C(NCCN)C=CC4=C3C2=NN4CCN(CC)CC)C=C1
Biological Activity: PD 121373 is a DNA complexing agent with antitumor activity. PD 121373 can bind tightly to DNA and RNA and inhibit the synthesis of DNA and RNA. The IC50 values of PD 121373 for inhibiting DNA and RNA synthesis in L1210 cells are 0.5 μM and 0.3 μM, respectively[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PD 121373 | PD 121373 is a DNA complexing agent with antitumor activity. PD 121373 can bind tightly to DNA and RNA and inhibit the synthesis of DNA and RNA. The IC50 values of PD 121373 for inhibiting DNA and RNA synthesis in L1210 cells are 0.5 μM and 0.3 μM, respectively. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||