10357-27-4
Chemical Structure
p-Nitrophenyl α-D-mannopyranoside
Synonym(s): 4-Nitrophenyl a-D-mannopyranoside
- CAS No.: 10357-27-4
- Formula:C12H15NO8
- Molecular Weight:301.25
IUPAC Name: (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-nitrophenoxy)tetrahydro-2H-pyran-3,4,5-triol
InChIKey: IFBHRQDFSNCLOZ-GCHJQGSQSA-N
SMILES: O[C@@H]([C@H]([C@@H]1O)O)[C@H](O[C@@H]1CO)OC(C=C2)=CC=C2[N](=O)=O
Biological Activity: p-Nitrophenyl α-D-mannopyranoside (4-Nitrophenyl α-D-mannopyranoside) is a chromogenic glycosidic ligand. p-Nitrophenyl α-D-mannopyranoside features a sugar moiety (α-D-mannopyranose) with the mannose-characteristic axial hydroxyl group at the C2 position and a ligand portion (p-nitrophenol) that provides ultraviolet-visible light absorption properties. p-Nitrophenyl α-D-mannopyranoside can be used to determine glycosidase activity and characterize the sugar recognition properties of lectins (such as Concanavalin A (HY-P2149))[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
p-Nitrophenyl α-D-mannopyranoside | 98.88% | p-Nitrophenyl α-D-mannopyranoside (4-Nitrophenyl α-D-mannopyranoside) is a chromogenic glycosidic ligand. p-Nitrophenyl α-D-mannopyranoside features a sugar moiety (α-D-mannopyranose) with the mannose-characteristic axial hydroxyl group at the C2 position and a ligand portion (p-nitrophenol) that provides ultraviolet-visible light absorption properties. p-Nitrophenyl α-D-mannopyranoside can be used to determine glycosidase activity and characterize the sugar recognition properties of lectins (such as Concanavalin A (HY-P2149)). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords