115532-52-0
Chemical Structure
TMRE
Synonym(s): Tetramethylrhodamine ethyl ester perchlorate
- CAS No.: 115532-52-0
- Formula:C26H27ClN2O7
- Molecular Weight:514.95
IUPAC Name: 3,6-bis(dimethylamino)-9-(2-(ethoxycarbonyl)phenyl)xanthylium perchlorate
InChIKey: NBAOBNBFGNQAEJ-UHFFFAOYSA-M
SMILES: O=C(C1=CC=CC=C1C2=C3C=CC(N(C)C)=CC3=[O+]C4=C2C=CC(N(C)C)=C4)OCC.O=Cl(=O)([O-])=O
Biological Activity: Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
TMRE | 98.49% | Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
TMRE (solution) | Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms. Solvent and concentration: DMSO: 10 mM |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||