117005-27-3
117005-27-3
Chemical Structure
Senkyunolide P
- CAS. Nr.: 117005-27-3
- Formula:C24H30O4
- Molecular Weight:382.49
InChIKey: YTEUTQUNVHWZOR-ATZDGDRESA-N
SMILES: CCCC[C@@H]1[C@@]23[C@@]4([H])C5=C(CC[C@@]4([H])[C@@](CC3)([H])C=C2C(O1)=O)/C(OC5=O)=C/CCC
Biological Activity: Senkyunolide P is a phthalide compound discovered from the rhizomes of Ligusticum chuanxiong Hort. Phthalides exhibit antioxidant, anti-inflammatory, and modulatory activities on pathways such as TLR4/NF-κB and Nrf2. Senkyunolide P can be used in research related to cardiovascular diseases[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Senkyunolide P | Senkyunolide P is a phthalide compound discovered from the rhizomes of Ligusticum chuanxiong Hort. Phthalides exhibit antioxidant, anti-inflammatory, and modulatory activities on pathways such as TLR4/NF-κB and Nrf2. Senkyunolide P can be used in research related to cardiovascular diseases. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
