1173020-21-7
Chemical Structure
3-Indoleacetic acid-d7
Synonym(s): Indole-3-acetic acid-d7;3-IAA-d7
- CAS No.: 1173020-21-7
- Formula:C10H2D7NO2
- Molecular Weight:182.23
IUPAC Name: (S)-4-(2-((1-(2-aminophenyl)-3-methylbutyl)amino)-2-oxoethyl)-2-(ethoxy-d5)benzoic acid
InChIKey: SEOVTRFCIGRIMH-PYNXLSDISA-N
SMILES: OC(C([2H])([2H])C1=C([2H])NC2=C([2H])C([2H])=C([2H])C([2H])=C12)=O
Biological Activity: 3-Indoleacetic acid-d7 (Indole-3-acetic acid-d7) is the deuterated-labeled 3-Indoleacetic acid (HY-18569). 3-Indoleacetic acid is is an IAA hormone and growth regulator that can promote plant nutritional growth through processes such as cell expansion, differentiation, morphogenesis, and organogenesis[2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3-Indoleacetic acid-d7 | 99.75% | 3-Indoleacetic acid-d7 (Indole-3-acetic acid-d7) is the deuterated-labeled 3-Indoleacetic acid (HY-18569). 3-Indoleacetic acid is is an IAA hormone and growth regulator that can promote plant nutritional growth through processes such as cell expansion, differentiation, morphogenesis, and organogenesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Indoleacetic acid (standard) | 99.83% | 3-Indoleacetic acid (standard) (Indole-3-acetic acid (standard)) is the analytical standard of 3-Indoleacetic acid (HY-18569). This product is intended for research and analytical applications. 3-Indoleacetic acid is is an IAA hormone and growth regulator that can promote plant nutritional growth through processes such as cell expansion, differentiation, morphogenesis, and organogenesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Indoleacetic acid-d4 | 3-Indoleacetic acid-d4 (Indole-3-acetic acid-d4) is the deuterated-labeled 3-Indoleacetic acid (HY-18569). 3-Indoleacetic acid is is an IAA hormone and growth regulator that can promote plant nutritional growth through processes such as cell expansion, differentiation, morphogenesis, and organogenesis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Indoleacetic acid-d5 | 99.76% | 3-Indoleacetic acid-d5 (Indole-3-acetic acid-d5) is the deuterated-labeled 3-Indoleacetic acid (HY-18569). 3-Indoleacetic acid is is an IAA hormone and growth regulator that can promote plant nutritional growth through processes such as cell expansion, differentiation, morphogenesis, and organogenesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Indoleacetic acid-2,2-d2 | 99.06% | 3-Indoleacetic acid-2,2-d2 (Indole-3-acetic acid-2,2-d2) is the deuterated-labeled 3-Indoleacetic acid (HY-18569). 3-Indoleacetic acid is is an IAA hormone and growth regulator that can promote plant nutritional growth through processes such as cell expansion, differentiation, morphogenesis, and organogenesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Indoleacetic acid-13C6 | 99.9% | 3-Indoleacetic acid-13C6 (Indole-3-acetic acid-13C6) is the 13C-labeled 3-Indoleacetic acid (HY-18569). 3-Indoleacetic acid is is an IAA hormone and growth regulator that can promote plant nutritional growth through processes such as cell expansion, differentiation, morphogenesis, and organogenesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Indoleacetic acid,suitable for plant cell culture | 99.78% | 3-Indoleacetic acid, suitable for plant cell culture (IAA), is a naturally occurring plant growth hormone that is widely present in plants, bacteria, and fungi. 3-Indoleacetic acid, suitable for plant cell culture, is a plant growth-promoting hormone that not only promotes plant growth but also protects bacteria from the toxic damage to cell membrane potential caused by other indole intermediate products (such as I3P) produced during their own metabolic processes. 3-Indoleacetic acid, suitable for plant cell culture, can be used in plant cell culture. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Indoleacetic acid | 99.94% | 3-Indoleacetic acid is is an IAA hormone and growth regulator that can promote plant nutritional growth through processes such as cell expansion, differentiation, morphogenesis, and organogenesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||