1190954-39-2
Chemical Structure
Norselic acid B
- CAS No.: 1190954-39-2
- Formula:C29H44O4
- Molecular Weight:456.66
InChIKey: KTOLWQCZNYCQTO-SHAFGOBASA-N
SMILES: OC([C@@]12[C@](CC[C@]2([H])[C@H](C)CC[C@@](CC)(O)C(C)=C)([H])[C@@]3([H])[C@]([C@@]4([C@@](CC(C=C4)=O)([H])CC3)C)([H])CC1)=O
Biological Activity: Norselic acid B is a natural compound that can be isolated from the sponge Crella sp. collected in Antarctica. T. Norselic acid B is active against the Leishmania parasite[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Norselic acid B | Norselic acid B is a natural compound that can be isolated from the sponge Crella sp. collected in Antarctica. T. Norselic acid B is active against the Leishmania parasite. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||