1200128-66-0
Chemical Structure
18-Deoxyherboxidiene
Synonym(s): RQN-18690A
- CAS No.: 1200128-66-0
- Formula:C25H42O5
- Molecular Weight:422.60
IUPAC Name: 2-((2R,5S,6S)-6-((S,2E,4E)-7-((2R,3R)-3-((2R,3S)-3-methoxypentan-2-yl)-2-methyloxiran-2-yl)-6-methylhepta-2,4-dien-2-yl)-5-methyltetrahydro-2H-pyran-2-yl)acetic acid
InChIKey: HRBJWKYIBBNOQT-YZDAHXQASA-N
SMILES: C[C@]1([C@]([C@@H]([C@H](CC)OC)C)([H])O1)C[C@H](C)/C=C/C=C(C)/[C@@H]2[C@@H](C)CC[C@H](CC(O)=O)O2
Biological Activity: 18-Deoxyherboxidiene (RQN-18690A) is a potent angiogenesis inhibitor. 18-Deoxyherboxidiene targets SF3b, a spliceosome component that is a subcomplex of the U2 small nuclear ribonucleoprotein (snRNP) in the spliceosome. 18-Deoxyherboxidiene inhibits the migration and tube formation of human umbilical vein endothelial cells (HUVECs) without significant cell toxicity. 18-Deoxyherboxidiene has the potential for cancer research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
18-Deoxyherboxidiene | 18-Deoxyherboxidiene (RQN-18690A) is a potent angiogenesis inhibitor. 18-Deoxyherboxidiene targets SF3b, a spliceosome component that is a subcomplex of the U2 small nuclear ribonucleoprotein (snRNP) in the spliceosome. 18-Deoxyherboxidiene inhibits the migration and tube formation of human umbilical vein endothelial cells (HUVECs) without significant cell toxicity. 18-Deoxyherboxidiene has the potential for cancer research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
