1356822-09-7
Chemical Structure
Narchinol B
- CAS No.: 1356822-09-7
- Formula:C12H16O3
- Molecular Weight:208.25
IUPAC Name: (4R,4aS,5R,7S)-4,7-dihydroxy-4a,5-dimethyl-4a,5,6,7-tetrahydronaphthalen-1(4H)-one
InChIKey: MPVZRKBKGSHLGP-FCMYFTRRSA-N
SMILES: C[C@@]([C@@H](C1)C)([C@@H](C=C2)O)C(C2=O)=C[C@H]1O
Biological Activity: Narchinol B (Compound 4) is a sesquiter penoid compound. Narchinol B has anti-inflammatory effects. Narchinol B works by inhibiting proinflammatory mediators, including prostaglandin E2 (PGE2), inducible nitric oxide synthase (iNOS), and cyclooxygenase-2 (COX-2) proteins, as well as proinflammatory cytokines, such as interleukin-1b, IL-6, and tumor necrosis factor-α (TNF-α). Narchinol B significantly inhibits LPS-induced overproduction of NO in BV2 cells (IC50=2.43 μM) [1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Narchinol B | Narchinol B (Compound 4) is a sesquiter penoid compound. Narchinol B has anti-inflammatory effects. Narchinol B works by inhibiting proinflammatory mediators, including prostaglandin E2 (PGE2), inducible nitric oxide synthase (iNOS), and cyclooxygenase-2 (COX-2) proteins, as well as proinflammatory cytokines, such as interleukin-1b, IL-6, and tumor necrosis factor-α (TNF-α). Narchinol B significantly inhibits LPS-induced overproduction of NO in BV2 cells (IC50=2.43 μM) . | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||