142279-40-1
Chemical Structure
Shizukaol B
- CAS No.: 142279-40-1
- Formula:C40H44O13
- Molecular Weight:732.77
InChIKey: NCEFZVURTXZBJM-QSDRZCANSA-N
SMILES: COC(/C(C)=C1[C@]2([H])[C@@]34[C@](CC5=C2[C@]([C@@]6([H])[C@]5([H])C6)([C@H](C/1=O)O)C)([H])[C@]7([C@@]8([H])[C@]([C@@]9([C@]7([H])CC3=C(COC(CCC(OC/C=C(C(OC9)=O)/C)=O)=O)C(O4)=O)O)([H])C8)C)=O
Biological Activity: Shizukaol B is a lindenane-type dimeric sesquiterpene, used to be isolated from the whole plant of Chloranthus henryi. Shizukaol B has anti-inflammatory effect against lipopolysaccharide (LPS)-induced activation of BV2 microglial cells. Shizukaol B inhibits iNOS and COX-2, and suppresses NO production, TNF-α, and IL-1β expression[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Shizukaol B | 96.0% | Shizukaol B is a lindenane-type dimeric sesquiterpene, used to be isolated from the whole plant of Chloranthus henryi. Shizukaol B has anti-inflammatory effect against lipopolysaccharide (LPS)-induced activation of BV2 microglial cells. Shizukaol B inhibits iNOS and COX-2, and suppresses NO production, TNF-α, and IL-1β expression. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
