145191-04-4
Chemical Structure
α-Linolenic acid-d5
- CAS No.: 145191-04-4
- Formula:C18H25D5O2
- Molecular Weight:283.46
IUPAC Name: (9Z,12Z,15Z)-octadeca-9,12,15-trienoic-17,17,18,18,18-d5 acid
InChIKey: DTOSIQBPPRVQHS-HIHMOWEVSA-N
SMILES: [2H]C([2H])(C([2H])(/C=C\C/C=C\C/C=C\CCCCCCCC(O)=O)[2H])[2H]
Biological Activity: α-Linolenic acid-d5 is the deuterium labeled α-Linolenic acid. α-Linolenic acid, isolated from seed oils, is an essential fatty acid that cannot be synthesized by humans. α-Linolenic acid can affect the process of thrombotic through the modulation of PI3K/Akt signaling. α-Linolenic acid possess the anti-arrhythmic properties and is related to cardiovascular disease and cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
α-Linolenic acid-d5 | α-Linolenic acid-d5 is the deuterium labeled α-Linolenic acid. α-Linolenic acid, isolated from seed oils, is an essential fatty acid that cannot be synthesized by humans. α-Linolenic acid can affect the process of thrombotic through the modulation of PI3K/Akt signaling. α-Linolenic acid possess the anti-arrhythmic properties and is related to cardiovascular disease and cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
α-Linolenic acid (Standard) | 99.32% | α-Linolenic acid (Standard) is the analytical standard of α-Linolenic acid. This product is intended for research and analytical applications. α-Linolenic acid, isolated from Perilla frutescens, is an essential fatty acid that cannot be synthesized by humans. α-Linolenic acid can affect the process of thrombotic through the modulation of PI3K/Akt signaling. α-Linolenic acid possess the anti-arrhythmic properties and is related to cardiovascular disease and cancer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
α-Linolenic acid-13C18 | 99.5% | α-Linolenic acid-13C18 is the 13C labeled α-Linolenic acid. α-Linolenic acid, isolated from seed oils, is an essential fatty acid that cannot be synthesized by humans. α-Linolenic acid can affect the process of thrombotic through the modulation of PI3K/Akt signaling. α-Linolenic acid possess the anti-arrhythmic properties and is related to cardiovascular disease and cancer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
α-Linolenic acid-d14 | α-Linolenic acid-d14 is the deuterium labeled α-Linolenic acid. α-Linolenic acid, isolated from seed oils, is an essential fatty acid that cannot be synthesized by humans. α-Linolenic acid can affect the process of thrombotic through the modulation of PI3K/Akt signaling. α-Linolenic acid possess the anti-arrhythmic properties and is related to cardiovascular disease and cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
α-Linolenic acid | 99.92% | α-Linolenic acid (ALA (free base); C18:3 (9Z,12Z,15Z) (free base); C18:3 n-3 (free base)) is an essential fatty acid that cannot be synthesized by humans. α-Linolenic acid can affect the process of thrombotic through the modulation of PI3K/Akt signaling. α-Linolenic acid possess the anti-arrhythmic properties and is related to cardiovascular disease and cancer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
