1459756-73-0
Chemical Structure
Cholesterol-PEG3-azide
- CAS No.: 1459756-73-0
- Formula:C39H66N4O6
- Molecular Weight:686.96
InChIKey: YNJQOXWHIGSFEB-QDCUHNIOSA-N
SMILES: [H][C@@]12CC=C3C[C@H](CC[C@@]3([C@]1(CC[C@]4([C@]2(CC[C@@]4([C@@H](CCCC(C)C)C)[H])[H])C)[H])C)OC(CCC(NCCOCCOCCOCCN=[N+]=[N-])=O)=O
Biological Activity: Cholesterol-PEG3-azide is a PEG derivative composed of Cholesterol, 3 PEG units and an azide group. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-driven alkyne-azide cycloaddition reaction (SPAAC) with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cholesterol-PEG3-azide | 99.41% | Cholesterol-PEG3-azide is a PEG derivative composed of Cholesterol, 3 PEG units and an azide group. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-driven alkyne-azide cycloaddition reaction (SPAAC) with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
