1562406-27-2
Chemical Structure
(S)-Acelarin
Synonym(s): (S)-NUC-1031; Fosgemcitabine palabenamide
- CAS No.: 1562406-27-2
- Formula:C25H27F2N4O8P
- Molecular Weight:580.47
IUPAC Name: benzyl ((S)-(((2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1(2H)-yl)-4,4-difluoro-3-hydroxytetrahydrofuran-2-yl)methoxy)(phenoxy)phosphoryl)-L-alaninate
InChIKey: NHTKGYOMICWFQZ-BBOXMAMFSA-N
SMILES: FC1([C@H](N2C(N=C(C=C2)N)=O)O[C@@H]([C@H]1O)CO[P@](OC3=CC=CC=C3)(N[C@@H](C)C(OCC4=CC=CC=C4)=O)=O)F
Biological Activity: (S)-Acelarin ((S)-NUC-1031) is an anti-cancer agent. (S)-Acelarin inhibits the growth of various cancer cells. (S)-Acelarin can be used for the study of solid tumors (e.g., pancreatic cancer, BTC, ovarian cancer) and hematological malignancies[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(S)-Acelarin | (S)-Acelarin ((S)-NUC-1031) is an anti-cancer agent. (S)-Acelarin inhibits the growth of various cancer cells. (S)-Acelarin can be used for the study of solid tumors (e.g., pancreatic cancer, BTC, ovarian cancer) and hematological malignancies. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||