162112-35-8
Chemical Structure
FM4-64
- CAS No.: 162112-35-8
- Formula:C30H45Br2N3
- Molecular Weight:607.51
IUPAC Name: 4-((1E,3E,5E)-6-(4-(diethylamino)phenyl)hexa-1,3,5-trien-1-yl)-1-(3-(triethylammonio)propyl)pyridin-1-ium bromide
InChIKey: AFVSZGYRRUMOFH-UHFFFAOYSA-L
SMILES: CC[N+](CCC[N+]1=CC=C(/C=C/C=C/C=C/C2=CC=C(N(CC)CC)C=C2)C=C1)(CC)CC.[Br-].[Br-]
Biological Activity: FM4-64 is a very lipophilic, water-soluble styrene dyes, can specifically bind to cell membranes and inner membrane organelles to produce fluorescence. FM4-64 is widely used in endocytic and exospic membrane structure markers.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
FM4-64 | 99.94% | FM4-64 is a very lipophilic, water-soluble styrene dyes, can specifically bind to cell membranes and inner membrane organelles to produce fluorescence. FM4-64 is widely used in endocytic and exospic membrane structure markers. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
FM4-64 (solution) | FM4-64 (solution) is a very lipophilic, water-soluble styrene dyes, can specifically bind to cell membranes and inner membrane organelles to produce fluorescence. FM4-64 is widely used in endocytic and exospic membrane structure markers. Solvent and concentration: DMSO: 5 mM |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||