1628046-32-1
1628046-32-1
Chemical Structure
Ceftolozane TFA
- CAS No.: 1628046-32-1
- Formula:C25H31F3N12O10S2
- Molecular Weight:780.71
InChIKey: PBZOVQQMQQYFDQ-TVNHLQOTSA-N
SMILES: [O-]C(C(F)(F)F)=O.OC(C1=C(C[N+]2=CC(NC(NCCN)=O)=C(N2C)N)CS[C@@]([C@@H]3NC(/C(C4=NSC(N)=N4)=N\OC(C)(C)C(O)=O)=O)([H])N1C3=O)=O
Biological Activity: Ceftolozane TFA is a cephalosporin antibiotic that can be used to inhibit Gram-negative bacterial infections. Ceftolozane TFA can be used to synthesize new antibiotic that are more potent and safer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ceftolozane TFA | 98.17% | Ceftolozane TFA is a cephalosporin antibiotic that can be used to inhibit Gram-negative bacterial infections. Ceftolozane TFA can be used to synthesize new antibiotic that are more potent and safer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ceftolozane TFA (Standard) | ≥98% | Ceftolozane TFA (Standard) is the analytical standard of Ceftolozane TFA (HY-106257A). This product is intended for research and analytical applications. Ceftolozane TFA is a cephalosporin antibiotic that can be used to inhibit Gram-negative bacterial infections. Ceftolozane TFA can be used to synthesize new antibiotic that are more potent and safer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ceftolozane-d6 TFA | Ceftolozane-d6 TFA is a deuterated labeled Ceftolozane TFA (HY-106257A). Ceftolozane TFA is a cephalosporin antibiotic that can be used to inhibit Gram-negative bacterial infections. Ceftolozane TFA can be used to synthesize new antibiotic that are more potent and safer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
