17019-92-0
Chemical Structure
11-Keto-beta-boswellic acid
Synonym(s): 11-Keto-β-boswellic acid
- CAS No.: 17019-92-0
- Formula:C30H46O4
- Molecular Weight:470.68
IUPAC Name: (3R,4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-3-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicene-4-carboxylic acid
InChIKey: YIMHGPSYDOGBPI-YZCVQEKWSA-N
SMILES: C[C@@]1([C@@]2(CC[C@]3(CC[C@H]([C@@H]([C@]3(C2=C4)[H])C)C)C)C)CC[C@@]5([H])[C@](C(O)=O)(C)[C@H](O)CC[C@]5(C)[C@@]1([H])C4=O
Biological Activity: 11-Keto-beta-boswellic acid (11-Keto-β-boswellic acid) is a pentacyclic triterpenic acid of the oleogum resin from the bark of the Boswellia serrate tree, popularly known as Indian Frankincense. 11-Keto-beta-boswellic acid has the anti-inflammatory activity is primarily due to inhibit 5-lipoxygenase (5-LOX) and subsequent leukotriene and nuclear factor-kappa B (NF-κB) activation and tumor necrosis factor alpha generation production[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
11-Keto-beta-boswellic acid | 99.90% | 11-Keto-beta-boswellic acid (11-Keto-β-boswellic acid) is a pentacyclic triterpenic acid of the oleogum resin from the bark of the Boswellia serrate tree, popularly known as Indian Frankincense. 11-Keto-beta-boswellic acid has the anti-inflammatory activity is primarily due to inhibit 5-lipoxygenase (5-LOX) and subsequent leukotriene and nuclear factor-kappa B (NF-κB) activation and tumor necrosis factor alpha generation production. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
11-Keto-beta-boswellic acid (Standard) | ≥98% | 11-Keto-beta-boswellic acid (Standard) is the analytical standard of 11-?Keto-?beta-?boswellic acid. This product is intended for research and analytical applications. 11-Keto-beta-boswellic acid (11-Keto-β-boswellic acid) is a pentacyclic triterpenic acid of the oleogum resin from the bark of the Boswellia serrate tree, popularly known as Indian Frankincense. 11-Keto-beta-boswellic acid has the anti-inflammatory activity is primarily due to inhibit 5-lipoxygenase (5-LOX) and subsequent leukotriene and nuclear factor-kappa B (NF-κB) activation and tumor necrosis factor alpha generation production. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
