17515-36-5
Chemical Structure
Tauroursocholic acid sodium
Synonym(s): TUCA sodium
- CAS No.: 17515-36-5
- Formula:C26H44NNaO7S
- Molecular Weight:537.68
SMILES: O[C@@H]1[C@@]2([H])[C@@]3([H])[C@@]([C@@](CC3)([H])[C@H](C)CCC(NCCS(=O)(O[Na])=O)=O)([C@H](C[C@]2([H])[C@@]4([C@](C[C@@H](CC4)O)([H])C1)C)O)C
Biological Activity: Tauroursocholic acid (TUCA) sodium is a taurine-conjugated form of the bile acid ursocholic acid and the 7β-hydroxy epimer of Taurocholic acid (HY-B1788). Tauroursocholic acid sodium exists in abundance during the biliary tract cancer, disrupting the balance and cellular toxicity of bile acids and inducing carcinogenesis through oxidative DNA damage and DNA mutation. Tauroursocholic acid (TUCA) sodium can be used for biliary tract cancer research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tauroursocholic acid sodium | Tauroursocholic acid (TUCA) sodium is a taurine-conjugated form of the bile acid ursocholic acid and the 7β-hydroxy epimer of Taurocholic acid (HY-B1788). Tauroursocholic acid sodium exists in abundance during the biliary tract cancer, disrupting the balance and cellular toxicity of bile acids and inducing carcinogenesis through oxidative DNA damage and DNA mutation. Tauroursocholic acid (TUCA) sodium can be used for biliary tract cancer research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
