1994299-33-0
Chemical Structure
L-Serine-13C3,15N,d3
Synonym(s): (-)-Serine-13C3,15N,d3;(S)-Serine-13C3,15N,d3
- CAS No.: 1994299-33-0
- Formula:13C3H4D315NO3
- Molecular Weight:112.08
IUPAC Name: L-aspartic-13C4-2,3,3-d3-15N acid
InChIKey: MTCFGRXMJLQNBG-UXVMDEDXSA-N
SMILES: O[13C]([13C@]([15NH2])([2H])[13C]([2H])([2H])O)=O
Biological Activity: L-Serine-13C3,15N,d3 is the deuterium, 13C-, and 15-labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
L-Serine-13C3,15N,d3 | 99.6% | L-Serine-13C3,15N,d3 is the deuterium, 13C-, and 15-labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine (Standard) | 98.37% | L-Serine (Standard) is the analytical standard of L-Serine. This product is intended for research and analytical applications. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine-15N,d3 | L-Serine-15N,d3 is the deuterium and 15N labeled L-Serine. L-Serine ((-)-Serine;(S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine-d3 | 99.75% | L-Serine-d3 is the deuterium labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine-1-13C | 99.9% | L-Serine-1-13C is the 13C-labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine-15N,d3 | L-Serine-15N,d3 is the deuterium and 15N-labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine-13C3,15N | 99.9% | L-Serine-13C3,15N is the 13C- and 15N-labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine1-13C,15N | 98.90% | L-Serine1-13C,15N is the 13C- and 15N-labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine-15N | 98.0% | L-Serine-15N is the 15N-labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine-2-13C | 99.71% | L-Serine-2-13C is the 13C-labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine-13C | 99.6% | L-Serine-13C is the 13C-labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine-d2 | 98.30% | L-Serine-d2 is the deuterium labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine-13C3 | 99.95% | L-Serine-13C3 is the 13C-labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine-d7 | 99.97% | L-Serine-d7 is the deuterium labeled L-Serine. L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Serine | 99.95% | L-Serine ((-)-Serine; (S)-Serine), one of the so-called non-essential amino acids, plays a central role in cellular proliferation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||