2042192-00-5
Chemical Structure
Janelia Fluor® 646, Tetrazine
Synonym(s): JF646, Tetrazine
- CAS No.: 2042192-00-5
- Formula:C38H35N7O3Si
- Molecular Weight:665.82
IUPAC Name: 4-((4-(1,2,4,5-tetrazin-3-yl)benzyl)carbamoyl)-2-(3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethyl-3,5-dihydrodibenzo[b,e]silin-10-yl)benzoate
InChIKey: CPWVRCGDSYQFSV-UHFFFAOYSA-N
SMILES: O=C(C1=C(C(C2=C([Si](C)(C)C3=C/4)C=C(N5CCC5)C=C2)=C3C=CC4=[N+]6CCC/6)C=C(C(NCC7=CC=C(C8=NN=CN=N8)C=C7)=O)C=C1)[O-]
Biological Activity: Janelia Fluor 646, Tetrazine (JF646, Tetrazine) a red fluorescent dye that contains a tetrazine group. JF646, Tetrazine can be used in cellular imaging[1]. Janelia Fluor fluorescent dyes can be chemically conjugated to the specific HaloTag substrate (a chloroalkane ligand) to form a fluorescent ligand, rather than binding directly to the HaloTag protein itself. Janelia Fluor products are licensed under U.S. Pat. Nos. 9,933,417, 10,018,624 and 10,161,932 and other patents from Howard Hughes Medical Institute. Janelia Fluor 646, Tetrazine is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups (Ex/Em = 646/664 nm).
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Janelia Fluor® 646, Tetrazine | 90.17% | Janelia Fluor 646, Tetrazine (JF646, Tetrazine) a red fluorescent dye that contains a tetrazine group. JF646, Tetrazine can be used in cellular imaging. Janelia Fluor fluorescent dyes can be chemically conjugated to the specific HaloTag substrate (a chloroalkane ligand) to form a fluorescent ligand, rather than binding directly to the HaloTag protein itself. Janelia Fluor products are licensed under U.S. Pat. Nos. 9,933,417, 10,018,624 and 10,161,932 and other patents from Howard Hughes Medical Institute. Janelia Fluor 646, Tetrazine is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups (Ex/Em = 646/664 nm). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
