2055732-24-4
Chemical Structure
Claficapavir
Synonym(s): A1752
- CAS No.: 2055732-24-4
- Formula:C17H12ClNO4S2
- Molecular Weight:393.86
IUPAC Name: (Z)-3-(5-((5-(4-chlorophenyl)furan-2-yl)methylene)-4-oxo-2-thioxothiazolidin-3-yl)propanoic acid
InChIKey: YZLFZFALAZYTCI-ZROIWOOFSA-N
SMILES: O=C(N(C(S/1)=S)CCC(O)=O)C1=C\C2=CC=C(C3=CC=C(C=C3)Cl)O2
Biological Activity: Claficapavir (A1752) is a specific nucleocapsid protein (NC) inhibitor with an IC50 around 1 μM. Claficapavir strongly binds the HIV-1 NC (Kd=20 nM) thereby inhibiting the chaperone properties of NC and leading to good antiviral activity against the HIV-1[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Claficapavir | 98.75% | Claficapavir (A1752) is a specific nucleocapsid protein (NC) inhibitor with an IC50 around 1 μM. Claficapavir strongly binds the HIV-1 NC (Kd=20 nM) thereby inhibiting the chaperone properties of NC and leading to good antiviral activity against the HIV-1. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||