2148986-33-6
Chemical Structure
Azido-PEG9-S-methyl ethanethioate
- CAS No.: 2148986-33-6
- Formula:C22H43N3O10S
- Molecular Weight:541.66
IUPAC Name: S-(29-azido-3,6,9,12,15,18,21,24,27-nonaoxanonacosyl) ethanethioate
InChIKey: UYMWTJAOBDYFDE-UHFFFAOYSA-N
SMILES: CC(SCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])=O
Biological Activity: Azido-PEG9-S-methyl ethanethioate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG9-S-methyl ethanethioate is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG9-S-methyl ethanethioate | 98.18% | Azido-PEG9-S-methyl ethanethioate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG9-S-methyl ethanethioate is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
