2408132-01-2
Chemical Structure
Bempedoic acid impurity 1-d4
- CAS No.: 2408132-01-2
- Formula:C19H30D4O5
- Molecular Weight:346.49
IUPAC Name: 1-((2-(methyl-d3)propan-2-yl-1,1,1,3,3,3-d6)amino)-3-((4-morpholino-1,2,5-thiadiazol-3-yl)oxy)propan-2-ol
InChIKey: NHVXRVOYVVPVDU-AREBVXNXSA-N
SMILES: OC(C(C)(C)CCCCC([2H])([2H])C(C([2H])([2H])CCCCC(C)(C)C(O)=O)=O)=O
Biological Activity: Bempedoic acid impurity 1-d4 is the deuterium labeled Bempedoic acid impurity 1[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Bempedoic acid impurity 1-d4 | 98.0% | Bempedoic acid impurity 1-d4 is the deuterium labeled Bempedoic acid impurity 1. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
ESP15228 | 98.0% | ESP15228 is a metabolite of Bempedoic acid (HY-12357). ESP15228 undergoes glucuronidation to form ESP15228-glucuronide. ESP15228 can form excretory ESP15228-taurine conjugate in feces. ESP15228-CoA is a selective hepatic ATP citrate lyase inhibitor. ESP15228 can be used in the research of hypercholesterolemia. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||