2483735-63-1
Chemical Structure
Ethynyl Estradiol-13C2
Synonym(s): 17α-Ethynylestradiol-13C2;Ethynylestradiol-13C2
- CAS No.: 2483735-63-1
- Formula:C1813C2H24O2
- Molecular Weight:298.39
IUPAC Name: (8R,9S,13S,14S,17R)-17-(ethynyl-13C2)-13-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-3,17-diol
InChIKey: BFPYWIDHMRZLRN-CUBXCOMFSA-N
SMILES: OC1=CC=C2C(CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@]4([13C]#[13CH])O)=C1
Biological Activity: Ethynyl Estradiol-13C2 is the 13C-labeled Ethynyl Estradiol. Ethynyl Estradiol-13C2 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ethynyl Estradiol-13C2 | 98.64% | Ethynyl Estradiol-13C2 is the 13C-labeled Ethynyl Estradiol. Ethynyl Estradiol-13C2 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ethinylestradiol (Standard) | 99.86% | Ethynyl Estradiol (Standard) is the analytical standard of Ethynyl Estradiol. This product is intended for research and analytical applications. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ethynyl Estradiol-d4 | 99.25% | Ethynyl Estradiol-d4 is the deuterium labeled Ethynyl Estradiol. Ethynyl Estradiol (17α-Ethynylestradiol;Ethynylestradiol) is an orally bio-active estrogen used in almost all modern formulations of combined oral contraceptive pills. Ethynyl Estradiol-d4 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ethinylestradiol | 99.96% | Ethinylestradiol is an orally active steroidal estrogen. Ethinylestradiol is widely used in research on menopausal symptoms, gynecological conditions, and certain hormone-sensitive cancers. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||