251647-50-4
Chemical Structure
5'-O-DMT-N2-Ibu-2'-OMe-G
- CAS No.: 251647-50-4
- Formula:C38H43N5O9
- Molecular Weight:713.78
InChIKey: XDLPRZLZAFJSMA-BEGXHNNXSA-N
SMILES: O=C1C2=C(N([C@H]3[C@H](OCCOC)[C@H](O)[C@@H](COC(C4=CC=C(OC)C=C4)(C5=CC=CC=C5)C6=CC=C(OC)C=C6)O3)C=N2)N=C(NC(C(C)C)=O)N1
Biological Activity: 5'-O-DMT-N2-Ibu-2'-OMe-G is a crucial intermediate for the synthesis of antisense oligonucleotides. 5'-O-DMT-N2-Ibu-2'-OMe-G is involved in constructing antisense oligonucleotides with specific sequences, which can bind complementarily to the targeted mRNA. 5'-O-DMT-N2-Ibu-2'-OMe-G blocks the translation process of mRNA, thereby inhibiting the expression of specific proteins and playing a role in regulating gene expression. 5'-O-DMT-N2-Ibu-2'-OMe-G is promising for research of genetic diseases and tumors[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5'-O-DMT-N2-Ibu-2'-OMe-G | 95.0% | 5'-O-DMT-N2-Ibu-2'-OMe-G is a crucial intermediate for the synthesis of antisense oligonucleotides. 5'-O-DMT-N2-Ibu-2'-OMe-G is involved in constructing antisense oligonucleotides with specific sequences, which can bind complementarily to the targeted mRNA. 5'-O-DMT-N2-Ibu-2'-OMe-G blocks the translation process of mRNA, thereby inhibiting the expression of specific proteins and playing a role in regulating gene expression. 5'-O-DMT-N2-Ibu-2'-OMe-G is promising for research of genetic diseases and tumors. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Taj SA, et al. Process development for the synthesis of 5'-O-(4,4'-dimethoxytrityl)-N2-isobutyryl-2'-O-(2-methoxyethyl)-guanosine--a potential precursor for the second generation antisense oligonucleotides: an improved process for the preparation of 2'-O-alkyl-2,6-diaminopurine riboside. Nucleosides Nucleotides Nucleic Acids. 2003 May-Aug;22(5-8):1327-30. [Content Brief]
Keywords
