2581824-70-4
Chemical Structure
Boc-Pip-alkyne-Ph-COOH
- CAS No.: 2581824-70-4
- Formula:C19H23NO4
- Molecular Weight:329.39
IUPAC Name: 4-((1-(tert-butoxycarbonyl)piperidin-4-yl)ethynyl)benzoic acid
InChIKey: MXFYILJORTXNER-UHFFFAOYSA-N
SMILES: OC(C1=CC=C(C#CC2CCN(C(OC(C)(C)C)=O)CC2)C=C1)=O
Biological Activity: Boc-Pip-alkyne-Ph-COOH is a PROTAC linker, which refers to the alkyl/ether composition. Boc-Pip-alkyne-Ph-COOH can be used in the synthesis of a series of PROTACs, such as ARD-266 (HY-133020). ARD-266 effectively induces degradation of androgen receptor (AR) protein in AR-positive LNCaP, VCaP, and 22Rv1 prostate cancer cell lines with DC50 values of 0.2-1 nM[1]. Boc-Pip-alkyne-Ph-COOH is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Boc-Pip-alkyne-Ph-COOH | Boc-Pip-alkyne-Ph-COOH is a PROTAC linker, which refers to the alkyl/ether composition. Boc-Pip-alkyne-Ph-COOH can be used in the synthesis of a series of PROTACs, such as ARD-266 (HY-133020). ARD-266 effectively induces degradation of androgen receptor (AR) protein in AR-positive LNCaP, VCaP, and 22Rv1 prostate cancer cell lines with DC50 values of 0.2-1 nM. Boc-Pip-alkyne-Ph-COOH is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
