2747915-76-8
Chemical Structure
Simvastatin hydroxy acid-d6sodium
Synonym(s): Tenivastatin-d6 sodium; Simvastatin impurity A-d6 sodium
- CAS No.: 2747915-76-8
- Formula:C25H33D6NaO6
- Molecular Weight:464.60
IUPAC Name: (S)-N1-((2S,3R)-4-((3S,4aS,8aS)-3-(tert-butylcarbamoyl)octahydroisoquinolin-2(1H)-yl)-3-hydroxy-1-phenylbutan-2-yl)-2-(quinoline-2-carboxamido-3,4,5,6,7,8-d6)succinamide
InChIKey: RLWRROYWKHUVKF-UUPPRYLMSA-M
SMILES: CCC(C([2H])([2H])[2H])(C([2H])([2H])[2H])C(O[C@@H]1[C@@]2([H])C(C=C[C@H](C)[C@@H]2CC[C@@H](O)C[C@@H](O)CC(O[Na])=O)=C[C@H](C)C1)=O
Biological Activity: Simvastatin hydroxy acid-d6 sodium (Tenivastatin-d6 sodium) is the deuterium labeled Simvastatin hydroxy acid sodium (HY-115292). Simvastatin hydroxy acid (Tenivastatin) sodium is a potent HMG-CoA reductase (HMGCR) inhibitor. Simvastatin hydroxy acid sodium reduces Indoxyl sulfate-mediated reactive oxygen species (ROS) production in human cardiomyocytes. Simvastatin hydroxy acid sodium can also modulates OATP3A1 expression in cardiomyocytes and HEK293 cells transfected with the OATP3A1 gene[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Simvastatin hydroxy acid-d6sodium | Simvastatin hydroxy acid-d6 sodium (Tenivastatin-d6 sodium) is the deuterium labeled Simvastatin hydroxy acid sodium (HY-115292). Simvastatin hydroxy acid (Tenivastatin) sodium is a potent HMG-CoA reductase (HMGCR) inhibitor. Simvastatin hydroxy acid sodium reduces Indoxyl sulfate-mediated reactive oxygen species (ROS) production in human cardiomyocytes. Simvastatin hydroxy acid sodium can also modulates OATP3A1 expression in cardiomyocytes and HEK293 cells transfected with the OATP3A1 gene. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Simvastatin hydroxy acid sodium | 99.86% | Simvastatin hydroxy acid (Tenivastatin) sodium is a potent HMG-CoA reductase (HMGCR) inhibitor. Simvastatin hydroxy acid sodium reduces Indoxyl sulfate-mediated reactive oxygen species (ROS) production in human cardiomyocytes. Simvastatin hydroxy acid sodium can also modulates OATP3A1 expression in cardiomyocytes and HEK293 cells transfected with the OATP3A1 gene. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
