2758875-01-1
Chemical Structure
DIBAC-GGFG-NH2CH2-Dxd
- CAS No.: 2758875-01-1
- Formula:C61H58FN9O12
- Molecular Weight:1128.16
InChIKey: HXQAFVZJVFQLRZ-WEARVGGQSA-N
SMILES: O=C(N1C2=CC=CC=C2C#CC3=CC=CC=C3C1)CCC(NCC(NCC(N[C@@H](CC4=CC=CC=C4)C(NCC(NCOCC(N[C@@H]5C6=C7C(C(N8C7)=CC([C@](O)(C(OC9)=O)CC)=C9C8=O)=NC%10=CC(F)=C(C)C(CC5)=C%106)=O)=O)=O)=O)=O)=O
Biological Activity: DIBAC-GGFG-NH2CH2-Dxd (compound LP4), a Camptothecin (HY-16560) derivative, is a linker-payload of protein-agent conjugates[1]. Dxd (HY-13631D) can be used as a payload for the antibody-coupling drug ADC (DS-8201a).DIBAC-GGFG-NH2CH2-Dxd is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DIBAC-GGFG-NH2CH2-Dxd | 98.57% | DIBAC-GGFG-NH2CH2-Dxd (compound LP4), a Camptothecin (HY-16560) derivative, is a linker-payload of protein-agent conjugates. Dxd (HY-13631D) can be used as a payload for the antibody-coupling drug ADC (DS-8201a).DIBAC-GGFG-NH2CH2-Dxd is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||