2807477-26-3
Chemical Structure
Monoamine Oxidase B inhibitor 2
- CAS. Nr.: 2807477-26-3
- Formula:C19H19FO3
- Molecular Weight:314.35
IUPAC Name: 3-butyl-6-((4-fluorobenzyl)oxy)isobenzofuran-1(3H)-one
InChIKey: UJJXFKIXMXWGET-UHFFFAOYSA-N
SMILES: CCCCC1OC(C2=CC(OCC3=CC=C(C=C3)F)=CC=C21)=O
Biological Activity: Monoamine Oxidase B inhibitor 2 is a potent, reversible, orally active and selective monoamine oxidase B (MAO-B) inhibitor with an IC50 of 1.33 nM. Monoamine Oxidase B inhibitor 2 has antioxidant and anti-neuroinflammatory activities. Monoamine Oxidase B inhibitor 2 can across the blood-brain barrier (BBB), and can be used for Parkinson’s disease study[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Monoamine Oxidase B inhibitor 2 | Monoamine Oxidase B inhibitor 2 is a potent, reversible, orally active and selective monoamine oxidase B (MAO-B) inhibitor with an IC50 of 1.33 nM. Monoamine Oxidase B inhibitor 2 has antioxidant and anti-neuroinflammatory activities. Monoamine Oxidase B inhibitor 2 can across the blood-brain barrier (BBB), and can be used for Parkinson’s disease study. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||