2912307-38-9
Chemical Structure
PROTAC PTPN2 degrader-2
- CAS No.: 2912307-38-9
- Formula:C49H49ClN6O11S2
- Molecular Weight:997.53
InChIKey: GTNMUWOJHCUFGS-OCZFFWILSA-N
SMILES: O=C1C2=C3C(N1[C@@H]4C(NC(CC4)=O)=O)=CC=C(C5CCN(CC5)C(NC6=CC(CS(=O)(N7C(C)(C[C@H](CC7)NC8=CC(C9=C(C(OCC(O)=O)=C(S9)C(O)=O)Cl)=CC=C8)C)=O)=CC=C6)=O)C3=CC=C2
Biological Activity: PROTAC PTPN2 degrader-2 is a potent PTPN2 PROTAC degrader with a DC50 of <50 nM. PROTAC PTPN2 degrader-2 is potential for studying cancer or metabolic diseases, such as colon cancer[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PROTAC PTPN2 degrader-2 | PROTAC PTPN2 degrader-2 is a potent PTPN2 PROTAC degrader with a DC50 of <50 nM. PROTAC PTPN2 degrader-2 is potential for studying cancer or metabolic diseases, such as colon cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||