3036674-82-2
3036674-82-2
Chemical Structure
2-(2-(2-(6-Azidohexanamido)ethoxy)ethoxy)acetic acid
- CAS No.: 3036674-82-2
- Formula:C12H22N4O5
- Molecular Weight:302.33
SMILES: O=C(O)COCCOCCNC(CCCCCN=[N+]=[N-])=O
Biological Activity: 2-(2-(2-(6-Azidohexanamido)ethoxy)ethoxy)acetic acid is a PROTACT linker and can be used for synthesis of P60-L3-VHL (HY-162943). 2-(2-(2-(6-Azidohexanamido)ethoxy)ethoxy)acetic acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2-(2-(2-(6-Azidohexanamido)ethoxy)ethoxy)acetic acid | 99.75% | 2-(2-(2-(6-Azidohexanamido)ethoxy)ethoxy)acetic acid is a PROTACT linker and can be used for synthesis of P60-L3-VHL (HY-162943). 2-(2-(2-(6-Azidohexanamido)ethoxy)ethoxy)acetic acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
