3093763-27-7
Chemical Structure
CDK12 ligand-3
- CAS No.: 3093763-27-7
- Formula:C25H28ClN5O3S
- Molecular Weight:514.04
InChIKey: UDXXTSWRYRQIPG-LJQANCHMSA-N
SMILES: ClC1=CN=C(N[C@H]2CN(CCC2)C(C3=CC=CC=C3)=O)N=C1NC4=CC=CC=C4S(=O)(C(C)C)=O
Biological Activity: CDK12 ligand-3 is a molecular glucose degrading agent that targets the CDK12 protein (DC50 = 35 nM). CDK12 ligand-3 degrades CDK12, CDK13 and their regulatory subunit Cyclin K in a concentration dependent manner, and inhibits RNA polymerase II CTD (Ser2) phosphorylation. CDK12 ligand-3 exhibits potent anti proliferative activity against Jurkat cells. CDK12 ligand-3 can be used for research on cancers such as leukemia[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
CDK12 ligand-3 | CDK12 ligand-3 is a molecular glucose degrading agent that targets the CDK12 protein (DC50 = 35 nM). CDK12 ligand-3 degrades CDK12, CDK13 and their regulatory subunit Cyclin K in a concentration dependent manner, and inhibits RNA polymerase II CTD (Ser2) phosphorylation. CDK12 ligand-3 exhibits potent anti proliferative activity against Jurkat cells. CDK12 ligand-3 can be used for research on cancers such as leukemia. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
