3132328-83-4
Chemical Structure
TMEM175 agonist 6
- CAS No.: 3132328-83-4
- Formula:C19H12F7N3O2
- Molecular Weight:447.31
InChIKey: VNJOAZITCYWAIF-SECBINFHSA-N
SMILES: O=C1N(C=CC2=CC(C(F)(F)F)=CC=C21)[C@@H](C(NC3=C(N=C(C=C3)C(F)(F)F)F)=O)C
Biological Activity: TMEM175 agonist 6 (Compound F-101) is a TMEM175 agonist. TMEM175 agonists can restore/enhance the function of lysosomes and reduce aSyn aggregation, thus being applicable for the research of diseases such as Parkinson's disease[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
TMEM175 agonist 6 | TMEM175 agonist 6 (Compound F-101) is a TMEM175 agonist. TMEM175 agonists can restore/enhance the function of lysosomes and reduce aSyn aggregation, thus being applicable for the research of diseases such as Parkinson's disease. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||