32426-11-2
Chemical Structure
Octyl decyldimethyl ammonium chloride
- CAS No.: 32426-11-2
- Formula:C20H44ClN
- Molecular Weight:334.03
IUPAC Name: N,N-dimethyl-N-octyldecan-1-aminium chloride
InChIKey: SCXCDVTWABNWLW-UHFFFAOYSA-M
SMILES: [Cl-].CCCCCCCCCC[N+](C)(C)CCCCCCCC
Biological Activity: Octyl decyldimethyl ammonium chloride, a quaternary ammonium salt, is an antibacterial agent. Octyl decyldimethyl ammonium chloride disrupts cell membranes, leading to cytotoxicity. Octyl decyldimethyl ammonium chloride has risk of skin irritation and increases pro-inflammatory IL-1α secretion[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Octyl decyldimethyl ammonium chloride | Octyl decyldimethyl ammonium chloride, a quaternary ammonium salt, is an antibacterial agent. Octyl decyldimethyl ammonium chloride disrupts cell membranes, leading to cytotoxicity. Octyl decyldimethyl ammonium chloride has risk of skin irritation and increases pro-inflammatory IL-1α secretion. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||