350993-69-0
Chemical Structure
(Rac)-Glutipyran
- CAS No.: 350993-69-0
- Formula:C30H37NO5
- Molecular Weight:491.62
SMILES: O=C(N(CCC(C1CCOC(C)(C1)C)C2=CC=CC=C2)CC3=CC=C(C(OC)=C3)OC)C4=CC=CO4
Biological Activity: (Rac)-Glutipyran is a broad-spectrum GLUT inhibitor that targets both GLUT1 and GLUT3. (Rac)-Glutipyran inhibits glucose uptake and suppresses the growth of multiple cancer cells, significantly inhibiting PANC-1 cell growth (IC50=1.8 μM) and glucose uptake (IC50=0.13 μM)[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(Rac)-Glutipyran | (Rac)-Glutipyran is a broad-spectrum GLUT inhibitor that targets both GLUT1 and GLUT3. (Rac)-Glutipyran inhibits glucose uptake and suppresses the growth of multiple cancer cells, significantly inhibiting PANC-1 cell growth (IC50=1.8 μM) and glucose uptake (IC50=0.13 μM). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||