478801-48-8
Chemical Structure
N3-C4-NHS ester
- CAS. Nr.: 478801-48-8
- Formula:C9H12N4O4
- Molecular Weight:240.22
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 5-azidopentanoate
InChIKey: PJHPYOOVTLZAOG-UHFFFAOYSA-N
SMILES: O=C(ON1C(CCC1=O)=O)CCCCN=[N+]=[N-]
Biological Activity: N3-C4-NHS ester is a noncleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). N3-C4-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-C4-NHS ester | 99.53% | N3-C4-NHS ester is a noncleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). N3-C4-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||