74317-53-6
Chemical Structure
Rhodamine B hydrazide
- CAS No.: 74317-53-6
- Formula:C28H32N4O2
- Molecular Weight:456.58
IUPAC Name: 2-amino-3',6'-bis(diethylamino)spiro[isoindoline-1,9'-xanthen]-3-one
InChIKey: WTDHTIVYKKLOTC-UHFFFAOYSA-N
SMILES: CCN(C1=CC2=C(C3(C4=CC=C(C=C4O2)N(CC)CC)C5=C(C(N3N)=O)C=CC=C5)C=C1)CC
Biological Activity:
Rhodamine B hydrazide is a fluorescent derivative based on rhodamine B, containing the spirocyclic structure of Rhodamine B (HY-Y0016), which can be used to detect copper ions (Cu2+), mercury ions, peroxynitrite, hydroxyl radicals and nitric oxide (NO)[1][2][3].
Excitation/emission wavelength:
Conventional detection: 510/578 nm.
Sulfite detection: 554 nm absorption, 574 nm emission (due to the formation of Rhodamine B fluorescent product).
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Rhodamine B hydrazide | 99.87% | Rhodamine B hydrazide is a fluorescent derivative based on rhodamine B, containing the spirocyclic structure of Rhodamine B (HY-Y0016), which can be used to detect copper ions (Cu2+), mercury ions, peroxynitrite, hydroxyl radicals and nitric oxide (NO). Excitation/emission wavelength: Conventional detection: 510/578 nm. Sulfite detection: 554 nm absorption, 574 nm emission (due to the formation of Rhodamine B fluorescent product). |
||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Yang X F, et al. Novel spectrofluorimetric method for the determination of sulfite with rhodamine B hydrazide in a micellar medium[J]. Analytica Chimica Acta, 2002, 456(1): 121-128.
- [2]. Suresh Kumar Kempahanumakkagaari, et al. A new rhodamine B based fluorometric chemodosimeter for Cu2+ ion in aqueous and cellular media. Journal of Luminescence Volume 146, February 2014, Pages 11-17.
- [3]. Wu CM, et al. Sensitivity evaluation of rhodamine B hydrazide towards nitric oxide and its application for macrophage cells imaging. Anal Chim Acta. 2011 Dec 5;708(1-2):141-8. [Content Brief]
Keywords
