90411-12-4
Chemical Structure
Neochamaejasmin B
Synonym(s): (+)-Neochamaejasmin B
- CAS No.: 90411-12-4
- Formula:C30H22O10
- Molecular Weight:542.49
IUPAC Name: (2R,2'S,3S,3'S)-5,5',7,7'-tetrahydroxy-2,2'-bis(4-hydroxyphenyl)-[3,3'-bichromane]-4,4'-dione
InChIKey: RNQBLQALVMHBKH-JQYHKRKISA-N
SMILES: O=C1[C@]([C@@]2([H])[C@@H](C3=CC=C(O)C=C3)OC4=CC(O)=CC(O)=C4C2=O)([H])[C@H](C5=CC=C(O)C=C5)OC6=CC(O)=CC(O)=C16
Biological Activity: Neochamaejasmin B is a biflavanone compound. Neochamaejasmin B is isolated from Stellera chamaejasme L. (Thymelaeaceae). Neochamaejasmin B has the cis-trans geometry at the C-2/C-3 and C-2″/C-3″ positions[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Neochamaejasmin B | 98.53% | Neochamaejasmin B is a biflavanone compound. Neochamaejasmin B is isolated from Stellera chamaejasme L. (Thymelaeaceae). Neochamaejasmin B has the cis-trans geometry at the C-2/C-3 and C-2″/C-3″ positions. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||