934294-22-1
Chemical Structure
Lansoprazole-d4
Synonym(s): AG-1749-d4
- CAS No.: 934294-22-1
- Formula:C16H10D4F3N3O2S
- Molecular Weight:373.39
IUPAC Name: 2-(((3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl)methyl)sulfinyl)-1H-benzo[d]imidazole-4,5,6,7-d4
InChIKey: MJIHNNLFOKEZEW-QFFDRWTDSA-N
SMILES: O=S(C1=NC2=C([2H])C([2H])=C([2H])C([2H])=C2N1)CC3=NC=CC(OCC(F)(F)F)=C3C
Biological Activity: Lansoprazole-d4 (AG-1749-d4) is a deuterium labeled Lansoprazole. Lansoprazole is a proton pump inhibitor which prevents the stomach from producing acid[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Lansoprazole-d4 | 99.82% | Lansoprazole-d4 (AG-1749-d4) is a deuterium labeled Lansoprazole. Lansoprazole is a proton pump inhibitor which prevents the stomach from producing acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Lansoprazole (Standard) | ≥98% | Lansoprazole (Standard) is the analytical standard of Lansoprazole. This product is intended for research and analytical applications. Lansoprazole (AG 1749) is an orally active proton pump inhibitor which prevents the stomach from producing acid. Lansoprazole (AG 1749) is a potent brain penetrant neutral sphingomyelinase (N-SMase) inhibitor (exosome inhibitor). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Lansoprazole | 99.92% | Lansoprazole (AG 1749) is an orally active proton pump inhibitor which prevents the stomach from producing acid. Lansoprazole (AG 1749) is a potent brain penetrant neutral sphingomyelinase (N-SMase) inhibitor (exosome inhibitor). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||