942615-25-0
Chemical Structure
Mogroside II B
- CAS No.: 942615-25-0
- Formula:C42H72O14
- Molecular Weight:801.01
IUPAC Name: (2R,3R,4S,5S,6R)-2-(((3S,8S,9R,10R,11R,13R,14S,17R)-11-hydroxy-17-((2R,5R)-5-hydroxy-6-methyl-6-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)heptan-2-yl)-4,4,9,13,14-pentamethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol
InChIKey: OMJOQOVMHUWPCF-VHLOEOCYSA-N
SMILES: C[C@]12[C@](CC=C3[C@@]2([H])CC[C@@H](C3(C)C)O[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)([H])[C@]5([C@](C[C@H]1O)([C@@](CC5)([H])[C@H](C)CC[C@@H](O)C(C)(C)O[C@@H]6O[C@@H]([C@H]([C@@H]([C@H]6O)O)O)CO)C)C
Biological Activity: Mogroside II B is a cucurbitane-type glycoside with a sweet taste in water. Mogroside II B inhibits the activation of Epstein Barr virus early antigen (EBV-EA) induced by Phorbol 12-myristate 13-acetate (TPA) (HY-18739). Mogroside II B exerts weak inhibitory effects on the activation of the nitric oxide (NO) donor (NOR1)[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Mogroside II B | Mogroside II B is a cucurbitane-type glycoside with a sweet taste in water. Mogroside II B inhibits the activation of Epstein Barr virus early antigen (EBV-EA) induced by Phorbol 12-myristate 13-acetate (TPA) (HY-18739). Mogroside II B exerts weak inhibitory effects on the activation of the nitric oxide (NO) donor (NOR1). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||