95311-95-8
Chemical Structure
Lucidenic acid B
- CAS No.: 95311-95-8
- Formula:C27H38O7
- Molecular Weight:474.59
IUPAC Name: (R)-4-((5R,7S,10S,12S,13R,14R,17R)-7,12-dihydroxy-4,4,10,13,14-pentamethyl-3,11,15-trioxo-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid
InChIKey: GYRDSOABOBCYST-HFAARYGVSA-N
SMILES: C[C@]12C3=C(C([C@@H](O)[C@@]1([C@]([C@H](C)CCC(O)=O)([H])CC2=O)C)=O)[C@@]4([C@@](C(C)(C(CC4)=O)C)([H])C[C@@H]3O)C
Biological Activity: Lucidenic acid B is a natural compound isolated from Ganoderma lucidum, induces apoptosis of cancer cells, and causes the activation of caspase-9 and caspase-3, and cleavage of PARP. Lucidenic acid B does not affect the cell cycle profile, or the number of necrotic cells[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Lucidenic acid B | 99.85% | Lucidenic acid B is a natural compound isolated from Ganoderma lucidum, induces apoptosis of cancer cells, and causes the activation of caspase-9 and caspase-3, and cleavage of PARP. Lucidenic acid B does not affect the cell cycle profile, or the number of necrotic cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
