1807530-07-9
Chemical Structure
N3-PEG3-C2-PFP ester
- CAS No.: 1807530-07-9
- Formula:C15H16F5N3O5
- Molecular Weight:413.30
IUPAC Name: perfluorophenyl 3-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)propanoate
InChIKey: ZBZNPFUVVAAJIK-UHFFFAOYSA-N
SMILES: O=C(OC1=C(F)C(F)=C(F)C(F)=C1F)CCOCCOCCOCCN=[N+]=[N-]
Biological Activity: N3-PEG3-C2-PFP ester is a nonclaevable 3-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). N3-PEG3-C2-PFP ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-PEG3-C2-PFP ester | N3-PEG3-C2-PFP ester is a nonclaevable 3-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). N3-PEG3-C2-PFP ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||