1670249-37-2
Chemical Structure
Azido-PEG9-acid
- CAS No.: 1670249-37-2
- Formula:C21H41N3O11
- Molecular Weight:511.56
IUPAC Name: 1-azido-3,6,9,12,15,18,21,24,27-nonaoxatriacontan-30-oic acid
InChIKey: SITPDBHRMHFFHS-UHFFFAOYSA-N
SMILES: O=C(O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG9-acid is a non-cleavable 9 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG9-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Azido-PEG9-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG9-acid | 97.74% | Azido-PEG9-acid is a non-cleavable 9 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG9-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Azido-PEG9-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||