136565-60-1
Chemical Structure
1,2-DLPC-d46
Synonym(s): 1,2-Dilauroyl-sn-glycero-3-phosphocholine-d46
- CAS No.: 136565-60-1
- Formula:C32H18D46NO8P
- Molecular Weight:668.11
InChIKey: IJFVSSZAOYLHEE-RJZXENECSA-N
SMILES: O=C(O[C@@H](COP([O-])(OCC[N+](C)(C)C)=O)COC(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]
Biological Activity: 1,2-DLPC-d46 (1,2-Dilauroyl-sn-glycero-3-phosphocholine-d46) is the deuterium labeled 1,2-DLPC. 1,2-DLPC (1,2-Dilauroyl-sn-glycero-3-phosphocholine) is a ligand for LRH-1 agonists. 1,2-DLPC is a phospholipid used in the synthesis of liposomes. 1,2-DLPC enhances fat breakdown and apoptosis in fat cells through a TNFα-dependent pathway, while also inhibiting palmitate-induced insulin resistance through PPARα-mediated inflammation in muscle cells[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
1,2-DLPC-d46 | 1,2-DLPC-d46 (1,2-Dilauroyl-sn-glycero-3-phosphocholine-d46) is the deuterium labeled 1,2-DLPC. 1,2-DLPC (1,2-Dilauroyl-sn-glycero-3-phosphocholine) is a ligand for LRH-1 agonists. 1,2-DLPC is a phospholipid used in the synthesis of liposomes. 1,2-DLPC enhances fat breakdown and apoptosis in fat cells through a TNFα-dependent pathway, while also inhibiting palmitate-induced insulin resistance through PPARα-mediated inflammation in muscle cells. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
1,2-DLPC (Standard) | ≥98% | 1,2-DLPC (Standard) is the analytical standard of 1,2-DLPC (HY-107737). This product is intended for research and analytical applications. 1,2-DLPC (1,2-Dilauroyl-sn-glycero-3-phosphocholine) is a ligand for LRH-1 agonists. 1,2-DLPC is a phospholipid used in the synthesis of liposomes. 1,2-DLPC enhances fat breaKdown and apoptosis in fat cells through a TNFα-dependent pathway, while also inhibiting palmitate-induced insulin resistance through PPARα-mediated inflammation in muscle cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
1,2-DLPC-d9 | 1,2-DLPC-d9 (1,2-Dilauroyl-sn-glycero-3-phosphocholine-d9) is the deuterium labeled 1,2-DLPC. 1,2-DLPC (1,2-Dilauroyl-sn-glycero-3-phosphocholine) is a ligand for LRH-1 agonists. 1,2-DLPC is a phospholipid used in the synthesis of liposomes. 1,2-DLPC enhances fat breakdown and apoptosis in fat cells through a TNFα-dependent pathway, while also inhibiting palmitate-induced insulin resistance through PPARα-mediated inflammation in muscle cells. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
1,2-DLPC-d55 | 1,2-DLPC-d55 (1,2-Dilauroyl-sn-glycero-3-phosphocholine-d55) is the deuterium labeled 1,2-DLPC. 1,2-DLPC (1,2-Dilauroyl-sn-glycero-3-phosphocholine) is a ligand for LRH-1 agonists. 1,2-DLPC is a phospholipid used in the synthesis of liposomes. 1,2-DLPC enhances fat breakdown and apoptosis in fat cells through a TNFα-dependent pathway, while also inhibiting palmitate-induced insulin resistance through PPARα-mediated inflammation in muscle cells. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
1,2-DLPC | 98.0% | 1,2-DLPC (1,2-Dilauroyl-sn-glycero-3-phosphocholine) is a ligand for LRH-1 agonists. 1,2-DLPC is a phospholipid used in the synthesis of liposomes. 1,2-DLPC enhances fat breakdown and apoptosis in fat cells through a TNFα-dependent pathway, while also inhibiting palmitate-induced insulin resistance through PPARα-mediated inflammation in muscle cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
