1373170-36-5
Chemical Structure
SN38-PAB-Lys(MMT)-oxydiacetamide-PEG8-N3
- CAS No.: 1373170-36-5
- Formula:C78H95N9O20
- Molecular Weight:1478.64
InChIKey: CNYMUXFAKRSPCQ-BWZHNGFGSA-N
SMILES: O=C1[C@](OC(OCC2=CC=C(NC([C@@H](NC(COCC(NCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])=O)=O)CCCCNC(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=C(OC)C=C5)=O)C=C2)=O)(CC)C6=C(CO1)C(N7CC8=C(CC)C9=CC(O)=CC=C9N=C8C7=C6)=O
Biological Activity: SN38-PAB-Lys(MMT)-oxydiacetamide-PEG8-N3 is a Drug-Linker Conjugate for ADC. SN38-PAB-Lys(MMT)-oxydiacetamide-PEG8-N3 consists of the anti-cancer agent SN38 (HY-13704) and a linker Lys(MMT)-PAB-oxydiacetamide-PEG8-N3 (HY-131157). SN38-PAB-Lys(MMT)-oxydiacetamide-PEG8-N3 can be used for synthesis of ADCs[1]. SN38-PAB-Lys(MMT)-oxydiacetamide-PEG8-N3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
SN38-PAB-Lys(MMT)-oxydiacetamide-PEG8-N3 | 95.08% | SN38-PAB-Lys(MMT)-oxydiacetamide-PEG8-N3 is a Drug-Linker Conjugate for ADC. SN38-PAB-Lys(MMT)-oxydiacetamide-PEG8-N3 consists of the anti-cancer agent SN38 (HY-13704) and a linker Lys(MMT)-PAB-oxydiacetamide-PEG8-N3 (HY-131157). SN38-PAB-Lys(MMT)-oxydiacetamide-PEG8-N3 can be used for synthesis of ADCs. SN38-PAB-Lys(MMT)-oxydiacetamide-PEG8-N3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||