139051-27-7
Chemical Structure
Anemarsaponin B
- CAS No.: 139051-27-7
- Formula:C45H74O18
- Molecular Weight:903.06
IUPAC Name: 2-((4,5-dihydroxy-6-(hydroxymethyl)-2-((6a,8a,9-trimethyl-10-(3-methyl-4-((3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)butyl)-2,2a,3,4,5,6,6a,6b,7,8,8a,8b,11a,12,12a,12b-hexadecahydro-1H-naphtho[2',1':4,5]indeno[2,1-b]furan-4-yl)oxy)tet
InChIKey: ROHLIYKWVMBBFX-UHFFFAOYSA-N
SMILES: OC1C(CO)OC(OC2CCC(C(CCC3(C)C4CC5C3C(C)=C(CCC(COC6OC(CO)C(O)C(O)C6O)C)O5)C4CC7)(C)C7C2)C(OC8OC(CO)C(O)C(O)C8O)C1O
Biological Activity: Anemarsaponin B is a steroidal saponin. Anemarsaponin B decreases the protein and mRNA levels of iNOS and COX-2. Anemarsaponin B reduces the expressions and productions of pro-inflammatory cytokines, including TNF-a and IL-6. Anemarsaponin B inhibits the nuclear translocation of the p65 subunit of NF-κB by blocking the phosphorylation of IκBα. Anemarsaponin B also inhibits the phosphorylation of MAP kinase kinases 3/6 (MKK3/6) and mixed lineage kinase 3 (MLK3). Anti-inflammatory effect [1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Anemarsaponin B | 99.43% | Anemarsaponin B is a steroidal saponin. Anemarsaponin B decreases the protein and mRNA levels of iNOS and COX-2. Anemarsaponin B reduces the expressions and productions of pro-inflammatory cytokines, including TNF-a and IL-6. Anemarsaponin B inhibits the nuclear translocation of the p65 subunit of NF-κB by blocking the phosphorylation of IκBα. Anemarsaponin B also inhibits the phosphorylation of MAP kinase kinases 3/6 (MKK3/6) and mixed lineage kinase 3 (MLK3). Anti-inflammatory effect . | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
