14410-23-2
Chemical Structure
Montanastatin
- CAS No.: 14410-23-2
- Formula:C36H60N4O12
- Molecular Weight:740.88
InChIKey: NGUGHCRMWIKICS-JUZPTULESA-N
SMILES: O=C1O[C@@H](C)C(N[C@@H](C(C)C)C(O[C@H](C(C)C)C(N[C@H](C(C)C)C(O[C@@H](C)C(N[C@@H](C(C)C)C(O[C@H](C(C)C)C(N[C@@H]1C(C)C)=O)=O)=O)=O)=O)=O)=O
Biological Activity: Montanastatin is an antitumor agent that can be isolated from the terrestrial actinomycete Streptomyces anulatus. Montanastatin inhibits the growth of various cancer cells. Montanastatin can be used in research related to lymphocytic leukemia, ovarian cancer, brain cancer, renal cancer, lung cancer, colon cancer and melanoma[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Montanastatin | Montanastatin is an antitumor agent that can be isolated from the terrestrial actinomycete Streptomyces anulatus. Montanastatin inhibits the growth of various cancer cells. Montanastatin can be used in research related to lymphocytic leukemia, ovarian cancer, brain cancer, renal cancer, lung cancer, colon cancer and melanoma. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||