1987883-22-6
1987883-22-6
Chemical Structure
2'-Deoxycytidine-13C9,15N3
Synonym(s): Deoxycytidine-13C9,15N3; Cytosine deoxyriboside-13C9,15N3; Deoxyribose cytidine-13C9,15N3
- CAS No.: 1987883-22-6
- Formula:13C9H1315N3O4
- Molecular Weight:239.13
InChIKey: CKTSBUTUHBMZGZ-QVZWTWABSA-N
SMILES: O=[13C]1[15N]([13C@H]2[13CH]([H])[13CH](O)[13C@@H]([13CH2]O)O2)[13CH]=[13CH][13C]([15NH2])=[15N]1
Biological Activity: 2'-Deoxycytidine-13C9,15N3 (Deoxycytidine-13C9,15N3; Cytosine deoxyriboside-13C9,15N3; Deoxyribose cytidine-13C9,15N3) is 13C and 15N-labeled 2'-Deoxycytidine (HY-D0184). 2'-Deoxycytidine, a deoxyribonucleoside, could inhibit biological effects of Bromodeoxyuridine (Brdu).
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2'-Deoxycytidine-13C9,15N3 | 98.74% | 2'-Deoxycytidine-13C9,15N3 (Deoxycytidine-13C9,15N3; Cytosine deoxyriboside-13C9,15N3; Deoxyribose cytidine-13C9,15N3) is 13C and 15N-labeled 2'-Deoxycytidine (HY-D0184). 2'-Deoxycytidine, a deoxyribonucleoside, could inhibit biological effects of Bromodeoxyuridine (Brdu). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2'-Deoxycytidine (Standard) | 99.95% | Cefaclor (monohydrate) (Standard) is the analytical standard of Cefaclor (monohydrate). This product is intended for research and analytical applications. Cefaclor is a well-absorbed orally active cephalosporin antibiotic. Cefaclor can specifically bind to specific for penicillin-binding protein 3 (PBP3). Cefaclor can be used for the research of depression and kinds of infections caused by bacteria, such as respiratory tract infections, bacterial bronchitis, pharyngitis and skin infections. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2'-Deoxycytidine-13C9 | 96.8% | 2'-Deoxycytidine-13C9 (Deoxycytidine-13C9; Cytosine deoxyriboside-13C9; Deoxyribose cytidine-13C9) is 13C-labeled 2'-Deoxycytidine (HY-D0184). 2'-Deoxycytidine, a deoxyribonucleoside, could inhibit biological effects of Bromodeoxyuridine (Brdu). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2'-Deoxycytidine-13C,15N3 | 2'-Deoxycytidine-13C,15N3 (Deoxycytidine-13C,15N3) is 13C and 15N labeled 2'-Deoxycytidine. 2'-Deoxycytidine, a deoxyribonucleoside, can inhibit biological effects of Bromodeoxyuridine (Brdu). 2'-Deoxycytidine is essential for the synthesis of nucleic acids, that can be used for the research of cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2'-Deoxycytidine-15N3 | 99.70% | 2'-Deoxycytidine-15N3 is the 15N labeled 2'-Deoxycytidine. 2'-Deoxycytidine, a deoxyribonucleoside, could inhibit biological effects of Bromodeoxyuridine (Brdu). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2'-Deoxycytidine-d13 | 2'-Deoxycytidine-d13 (Deoxycytidine-d13; Cytosine deoxyriboside-d13; Deoxyribose cytidine-d13) is deuterium labeled 2'-Deoxycytidine (HY-D0184). 2'-Deoxycytidine, a deoxyribonucleoside, could inhibit biological effects of Bromodeoxyuridine (Brdu). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2'-Deoxycytidine-2'-13C | 2'-Deoxycytidine-2'-13C is 13C labeled 2'-Deoxycytidine. 2'-Deoxycytidine, a deoxyribonucleoside, can inhibit biological effects of Bromodeoxyuridine (Brdu). 2'-Deoxycytidine is essential for the synthesis of nucleic acids, that can be used for the research of cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2'-Deoxycytidine | 99.95% | 2'-Deoxycytidine, a deoxyribonucleoside, can inhibit biological effects of Bromodeoxyuridine (Brdu). 2'-Deoxycytidine is essential for the synthesis of nucleic acids, that can be used for the research of cancer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
