247568-68-9
Chemical Structure
(R)-Xanthoanthrafil
- CAS No.: 247568-68-9
- Formula:C19H23N3O6
- Molecular Weight:389.40
IUPAC Name: (R)-N-(3,4-dimethoxybenzyl)-2-((1-hydroxypropan-2-yl)amino)-5-nitrobenzamide
InChIKey: ZISFCTXLAXIEMV-GFCCVEGCSA-N
SMILES: O=C(NCC1=CC=C(OC)C(OC)=C1)C2=CC([N+]([O-])=O)=CC=C2N[C@H](C)CO
Biological Activity: (R)-Xanthoanthrafil is a phosphodiesterase-5 (PDE5) inhibitor. (R)-Xanthoanthrafil selectively inhibits PDE5, increasing cyclic guanosine monophosphate (cGMP) levels, leading to smooth muscle relaxation and promoting penile erection. (R)-Xanthoanthrafil can be used to study erectile dysfunction[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(R)-Xanthoanthrafil | (R)-Xanthoanthrafil is a phosphodiesterase-5 (PDE5) inhibitor. (R)-Xanthoanthrafil selectively inhibits PDE5, increasing cyclic guanosine monophosphate (cGMP) levels, leading to smooth muscle relaxation and promoting penile erection. (R)-Xanthoanthrafil can be used to study erectile dysfunction. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||