3103526-19-5
Chemical Structure
Bis-sulfone-(PEG24)-Glu-Val-Cit-PAB-MMAE
- CAS No.: 3103526-19-5
- Formula:C137H222N12O44S2
- Molecular Weight:2805.41
SMILES: O=C(OCC1=CC=C(NC([C@H](CCCNC(N)=O)NC([C@H](C(C)C)NC(CC[C@H](NC(C2=CC=C(C(C(CS(=O)(C3=CC=C(C)C=C3)=O)CS(=O)(C4=CC=C(C)C=C4)=O)=O)C=C2)=O)C(NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC)=O)=O)=O)=O)C=C1)N([C@@H](C(C)C)C(N[C@@H](C(C)C)C(N([C@@H]([C@@H](C)CC)[C@H](OC)CC(N5[C@H]([C@H](OC)[C@@H](C)C(N[C@H](C)[C@@H](O)C6=CC=CC=C6)=O)CCC5)=O)C)=O)=O)C
Biological Activity: Bis-sulfone-(PEG24)-Glu-Val-Cit-PAB-MMAE is a drug-linker conjugate for ADC. Bis-sulfone-(PEG24)-Glu-Val-Cit-PAB-MMAE contains a linker and bioactive small molecule toxins MMAE (HY-15162). Bis-sulfone-(PEG24)-Glu-Val-Cit-PAB-MMAE can conjugate with NN2101 (HY-P991293) (anti c-Kit) for synthesizing NN3201. NN3201 rapidly internalizes and inhibits SCF-driven signaling, thereby delivering its payload to induce cell cycle arrest and apoptosis. NN3201 exhibits significant c-Kit-dependent anti-tumor efficacies in various tumor models, such as small cell lung cancer (SCLC) and gastrointestinal stromal tumor (GIST)[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Bis-sulfone-(PEG24)-Glu-Val-Cit-PAB-MMAE | 97.88% | Bis-sulfone-(PEG24)-Glu-Val-Cit-PAB-MMAE is a drug-linker conjugate for ADC. Bis-sulfone-(PEG24)-Glu-Val-Cit-PAB-MMAE contains a linker and bioactive small molecule toxins MMAE (HY-15162). Bis-sulfone-(PEG24)-Glu-Val-Cit-PAB-MMAE can conjugate with NN2101 (HY-P991293) (anti c-Kit) for synthesizing NN3201. NN3201 rapidly internalizes and inhibits SCF-driven signaling, thereby delivering its payload to induce cell cycle arrest and apoptosis. NN3201 exhibits significant c-Kit-dependent anti-tumor efficacies in various tumor models, such as small cell lung cancer (SCLC) and gastrointestinal stromal tumor (GIST). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||